C15H21ClN4 — CID 111800596
2-[2-(5-chloro-1H-indol-3-yl)ethyl]-1,1-diethylguanidine (PubChem CID 111800596) has the molecular formula C15H21ClN4 and a molecular weight of 292.81 g/mol. Its IUPAC name is 2-[2-(5-chloro-1H-indol-3-yl)ethyl]-1,1-diethylguanidine.
| Compound Name | 2-[2-(5-chloro-1H-indol-3-yl)ethyl]-1,1-diethylguanidine |
|---|---|
| PubChem CID | 111800596 |
| Molecular Formula | C15H21ClN4 |
| Molecular Weight | 292.81 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | 2-[2-(5-chloro-1H-indol-3-yl)ethyl]-1,1-diethylguanidine |
| SMILES | CCN(CC)/C(N)=N/CCc1c[nH]c2ccc(Cl)cc12 |
| InChI | InChI=1S/C15H21ClN4/c1-3-20(4-2)15(17)18-8-7-11-10-19-14-6-5-12(16)9-13(11)14/h5-6,9-10,19H,3-4,7-8H2,1-2H3,(H2,17,18) |
| InChIKey | RCCUANNEMZFXFR-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 57.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.81 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|