C17H19ClN4S — CID 111800554
1-[2-(5-chloro-1H-indol-3-yl)ethyl]-2-(2-thiophen-2-ylethyl)guanidine (PubChem CID 111800554) has the molecular formula C17H19ClN4S and a molecular weight of 346.89 g/mol. Its IUPAC name is 1-[2-(5-chloro-1H-indol-3-yl)ethyl]-2-(2-thiophen-2-ylethyl)guanidine.
| Compound Name | 1-[2-(5-chloro-1H-indol-3-yl)ethyl]-2-(2-thiophen-2-ylethyl)guanidine |
|---|---|
| PubChem CID | 111800554 |
| Molecular Formula | C17H19ClN4S |
| Molecular Weight | 346.89 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | 1-[2-(5-chloro-1H-indol-3-yl)ethyl]-2-(2-thiophen-2-ylethyl)guanidine |
| SMILES | N/C(=N\CCc1cccs1)NCCc1c[nH]c2ccc(Cl)cc12 |
| InChI | InChI=1S/C17H19ClN4S/c18-13-3-4-16-15(10-13)12(11-22-16)5-7-20-17(19)21-8-6-14-2-1-9-23-14/h1-4,9-11,22H,5-8H2,(H3,19,20,21) |
| InChIKey | UJOMKQLPSZQTDU-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 66.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.89 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|