C16H20BrClN4OS — CID 138996591
4-chloro-N-[2-[[N'-(2-thiophen-2-ylethyl)carbamimidoyl]amino]ethyl]benzamide;hydrobromide (PubChem CID 138996591) has the molecular formula C16H20BrClN4OS and a molecular weight of 431.79 g/mol. Its IUPAC name is 4-chloro-N-[2-[[N'-(2-thiophen-2-ylethyl)carbamimidoyl]amino]ethyl]benzamide;hydrobromide.
| Compound Name | 4-chloro-N-[2-[[N'-(2-thiophen-2-ylethyl)carbamimidoyl]amino]ethyl]benzamide;hydrobromide |
|---|---|
| PubChem CID | 138996591 |
| Molecular Formula | C16H20BrClN4OS |
| Molecular Weight | 431.79 g/mol |
| Exact Mass | 430.02 |
| IUPAC Name | 4-chloro-N-[2-[[N'-(2-thiophen-2-ylethyl)carbamimidoyl]amino]ethyl]benzamide;hydrobromide |
| SMILES | Br.N/C(=N\CCc1cccs1)NCCNC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H19ClN4OS.BrH/c17-13-5-3-12(4-6-13)15(22)19-9-10-21-16(18)20-8-7-14-2-1-11-23-14;/h1-6,11H,7-10H2,(H,19,22)(H3,18,20,21);1H |
| InChIKey | NCTQTBCJHMCONG-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.79 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|