C13H22IN3O2S — CID 111037107
propan-2-yl 3-[[N'-(2-thiophen-2-ylethyl)carbamimidoyl]amino]propanoate;hydroiodide (PubChem CID 111037107) has the molecular formula C13H22IN3O2S and a molecular weight of 411.31 g/mol. Its IUPAC name is propan-2-yl 3-[[N'-(2-thiophen-2-ylethyl)carbamimidoyl]amino]propanoate;hydroiodide.
| Compound Name | propan-2-yl 3-[[N'-(2-thiophen-2-ylethyl)carbamimidoyl]amino]propanoate;hydroiodide |
|---|---|
| PubChem CID | 111037107 |
| Molecular Formula | C13H22IN3O2S |
| Molecular Weight | 411.31 g/mol |
| Exact Mass | 411.05 |
| IUPAC Name | propan-2-yl 3-[[N'-(2-thiophen-2-ylethyl)carbamimidoyl]amino]propanoate;hydroiodide |
| SMILES | CC(C)OC(=O)CCN/C(N)=N/CCc1cccs1.I |
| InChI | InChI=1S/C13H21N3O2S.HI/c1-10(2)18-12(17)6-8-16-13(14)15-7-5-11-4-3-9-19-11;/h3-4,9-10H,5-8H2,1-2H3,(H3,14,15,16);1H |
| InChIKey | SVHGECQETACNAQ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.31 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|