C10H15FN4O — CID 134432891
N-(diaminomethylidene)-3-fluoro-4-(2-methylpropyl)-1H-pyrrole-2-carboxamide (PubChem CID 134432891) has the molecular formula C10H15FN4O and a molecular weight of 226.25 g/mol. Its IUPAC name is N-(diaminomethylidene)-3-fluoro-4-(2-methylpropyl)-1H-pyrrole-2-carboxamide.
| Compound Name | N-(diaminomethylidene)-3-fluoro-4-(2-methylpropyl)-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 134432891 |
| Molecular Formula | C10H15FN4O |
| Molecular Weight | 226.25 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | N-(diaminomethylidene)-3-fluoro-4-(2-methylpropyl)-1H-pyrrole-2-carboxamide |
| SMILES | CC(C)Cc1c[nH]c(C(=O)N=C(N)N)c1F |
| InChI | InChI=1S/C10H15FN4O/c1-5(2)3-6-4-14-8(7(6)11)9(16)15-10(12)13/h4-5,14H,3H2,1-2H3,(H4,12,13,15,16) |
| InChIKey | HUUUQYUPIPDOMP-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 97.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.25 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|