C12H13F3N6 — CID 146250279
1-(diaminomethylidene)-2-[2-(5,6,7-trifluoro-1H-indol-3-yl)ethyl]guanidine (PubChem CID 146250279) has the molecular formula C12H13F3N6 and a molecular weight of 298.27 g/mol. Its IUPAC name is 1-(diaminomethylidene)-2-[2-(5,6,7-trifluoro-1H-indol-3-yl)ethyl]guanidine.
| Compound Name | 1-(diaminomethylidene)-2-[2-(5,6,7-trifluoro-1H-indol-3-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 146250279 |
| Molecular Formula | C12H13F3N6 |
| Molecular Weight | 298.27 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | 1-(diaminomethylidene)-2-[2-(5,6,7-trifluoro-1H-indol-3-yl)ethyl]guanidine |
| SMILES | NC(N)=N/C(N)=N/CCc1c[nH]c2c(F)c(F)c(F)cc12 |
| InChI | InChI=1S/C12H13F3N6/c13-7-3-6-5(1-2-19-12(18)21-11(16)17)4-20-10(6)9(15)8(7)14/h3-4,20H,1-2H2,(H6,16,17,18,19,21) |
| InChIKey | JNJPZZNLOVQCBX-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 118.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.27 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|