C15H19F3N2 — CID 166157959
N-ethyl-N-[2-(5,6,7-trifluoro-1H-indol-3-yl)ethyl]propan-1-amine (PubChem CID 166157959) has the molecular formula C15H19F3N2 and a molecular weight of 284.33 g/mol. Its IUPAC name is N-ethyl-N-[2-(5,6,7-trifluoro-1H-indol-3-yl)ethyl]propan-1-amine.
| Compound Name | N-ethyl-N-[2-(5,6,7-trifluoro-1H-indol-3-yl)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 166157959 |
| Molecular Formula | C15H19F3N2 |
| Molecular Weight | 284.33 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | N-ethyl-N-[2-(5,6,7-trifluoro-1H-indol-3-yl)ethyl]propan-1-amine |
| SMILES | CCCN(CC)CCc1c[nH]c2c(F)c(F)c(F)cc12 |
| InChI | InChI=1S/C15H19F3N2/c1-3-6-20(4-2)7-5-10-9-19-15-11(10)8-12(16)13(17)14(15)18/h8-9,19H,3-7H2,1-2H3 |
| InChIKey | BUBPAPNZVPCEIC-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.33 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|