C12H10ClF3N2O — CID 146100755
2-chloro-N-[2-(5,6,7-trifluoro-1H-indol-3-yl)ethyl]acetamide (PubChem CID 146100755) has the molecular formula C12H10ClF3N2O and a molecular weight of 290.67 g/mol. Its IUPAC name is 2-chloro-N-[2-(5,6,7-trifluoro-1H-indol-3-yl)ethyl]acetamide.
| Compound Name | 2-chloro-N-[2-(5,6,7-trifluoro-1H-indol-3-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 146100755 |
| Molecular Formula | C12H10ClF3N2O |
| Molecular Weight | 290.67 g/mol |
| Exact Mass | 290.04 |
| IUPAC Name | 2-chloro-N-[2-(5,6,7-trifluoro-1H-indol-3-yl)ethyl]acetamide |
| SMILES | O=C(CCl)NCCc1c[nH]c2c(F)c(F)c(F)cc12 |
| InChI | InChI=1S/C12H10ClF3N2O/c13-4-9(19)17-2-1-6-5-18-12-7(6)3-8(14)10(15)11(12)16/h3,5,18H,1-2,4H2,(H,17,19) |
| InChIKey | CBXZPKKNEGHATB-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.67 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|