C10H11F3N2O — CID 110477577
2-amino-N-[2-(2,3,4-trifluorophenyl)ethyl]acetamide (PubChem CID 110477577) has the molecular formula C10H11F3N2O and a molecular weight of 232.20 g/mol. Its IUPAC name is 2-amino-N-[2-(2,3,4-trifluorophenyl)ethyl]acetamide.
| Compound Name | 2-amino-N-[2-(2,3,4-trifluorophenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 110477577 |
| Molecular Formula | C10H11F3N2O |
| Molecular Weight | 232.20 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | 2-amino-N-[2-(2,3,4-trifluorophenyl)ethyl]acetamide |
| SMILES | NCC(=O)NCCc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C10H11F3N2O/c11-7-2-1-6(9(12)10(7)13)3-4-15-8(16)5-14/h1-2H,3-5,14H2,(H,15,16) |
| InChIKey | LEGVUNASIZMLPP-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.20 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|