C9H10F2N2O — CID 82670923
2-amino-N-[(2,3-difluorophenyl)methyl]acetamide (PubChem CID 82670923) has the molecular formula C9H10F2N2O and a molecular weight of 200.19 g/mol. Its IUPAC name is 2-amino-N-[(2,3-difluorophenyl)methyl]acetamide.
| Compound Name | 2-amino-N-[(2,3-difluorophenyl)methyl]acetamide |
|---|---|
| PubChem CID | 82670923 |
| Molecular Formula | C9H10F2N2O |
| Molecular Weight | 200.19 g/mol |
| Exact Mass | 200.08 |
| IUPAC Name | 2-amino-N-[(2,3-difluorophenyl)methyl]acetamide |
| SMILES | NCC(=O)NCc1cccc(F)c1F |
| InChI | InChI=1S/C9H10F2N2O/c10-7-3-1-2-6(9(7)11)5-13-8(14)4-12/h1-3H,4-5,12H2,(H,13,14) |
| InChIKey | HNNPDMAOAJWWIW-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.19 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |