C13H17F3N2O — CID 110482622
6-amino-N-[(2,3,4-trifluorophenyl)methyl]hexanamide (PubChem CID 110482622) has the molecular formula C13H17F3N2O and a molecular weight of 274.29 g/mol. Its IUPAC name is 6-amino-N-[(2,3,4-trifluorophenyl)methyl]hexanamide.
| Compound Name | 6-amino-N-[(2,3,4-trifluorophenyl)methyl]hexanamide |
|---|---|
| PubChem CID | 110482622 |
| Molecular Formula | C13H17F3N2O |
| Molecular Weight | 274.29 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | 6-amino-N-[(2,3,4-trifluorophenyl)methyl]hexanamide |
| SMILES | NCCCCCC(=O)NCc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C13H17F3N2O/c14-10-6-5-9(12(15)13(10)16)8-18-11(19)4-2-1-3-7-17/h5-6H,1-4,7-8,17H2,(H,18,19) |
| InChIKey | KVUDQRAYOPJLAH-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.29 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|