C14H11F3N2O — CID 110481973
N-[2-(2,3,4-trifluorophenyl)ethyl]pyridine-2-carboxamide (PubChem CID 110481973) has the molecular formula C14H11F3N2O and a molecular weight of 280.25 g/mol. Its IUPAC name is N-[2-(2,3,4-trifluorophenyl)ethyl]pyridine-2-carboxamide.
| Compound Name | N-[2-(2,3,4-trifluorophenyl)ethyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 110481973 |
| Molecular Formula | C14H11F3N2O |
| Molecular Weight | 280.25 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | N-[2-(2,3,4-trifluorophenyl)ethyl]pyridine-2-carboxamide |
| SMILES | O=C(NCCc1ccc(F)c(F)c1F)c1ccccn1 |
| InChI | InChI=1S/C14H11F3N2O/c15-10-5-4-9(12(16)13(10)17)6-8-19-14(20)11-3-1-2-7-18-11/h1-5,7H,6,8H2,(H,19,20) |
| InChIKey | PONRBWJUESDTFO-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.25 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|