C14H16ClF3N6O — CID 158913037
2-[2-(3-chloro-7H-cyclopenta[b]pyridin-5-yl)ethyl]-1-(diaminomethylidene)guanidine;2,2,2-trifluoroacetaldehyde (PubChem CID 158913037) has the molecular formula C14H16ClF3N6O and a molecular weight of 376.77 g/mol. Its IUPAC name is 2-[2-(3-chloro-7H-cyclopenta[b]pyridin-5-yl)ethyl]-1-(diaminomethylidene)guanidine;2,2,2-trifluoroacetaldehyde.
| Compound Name | 2-[2-(3-chloro-7H-cyclopenta[b]pyridin-5-yl)ethyl]-1-(diaminomethylidene)guanidine;2,2,2-trifluoroacetaldehyde |
|---|---|
| PubChem CID | 158913037 |
| Molecular Formula | C14H16ClF3N6O |
| Molecular Weight | 376.77 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | 2-[2-(3-chloro-7H-cyclopenta[b]pyridin-5-yl)ethyl]-1-(diaminomethylidene)guanidine;2,2,2-trifluoroacetaldehyde |
| SMILES | NC(N)=N/C(N)=N/CCC1=CCc2ncc(Cl)cc21.O=CC(F)(F)F |
| InChI | InChI=1S/C12H15ClN6.C2HF3O/c13-8-5-9-7(1-2-10(9)18-6-8)3-4-17-12(16)19-11(14)15;3-2(4,5)1-6/h1,5-6H,2-4H2,(H6,14,15,16,17,19);1H |
| InChIKey | JGWRMMDZXFAKMV-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 132.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.77 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|