C13H20FN5 — CID 21492988
1-ethyl-2-[N'-[1-(4-fluorophenyl)ethyl]carbamimidoyl]-1-methylguanidine (PubChem CID 21492988) has the molecular formula C13H20FN5 and a molecular weight of 265.34 g/mol. Its IUPAC name is 1-ethyl-2-[N'-[1-(4-fluorophenyl)ethyl]carbamimidoyl]-1-methylguanidine.
| Compound Name | 1-ethyl-2-[N'-[1-(4-fluorophenyl)ethyl]carbamimidoyl]-1-methylguanidine |
|---|---|
| PubChem CID | 21492988 |
| Molecular Formula | C13H20FN5 |
| Molecular Weight | 265.34 g/mol |
| Exact Mass | 265.17 |
| IUPAC Name | 1-ethyl-2-[N'-[1-(4-fluorophenyl)ethyl]carbamimidoyl]-1-methylguanidine |
| SMILES | CCN(C)/C(N)=N/C(N)=N/C(C)c1ccc(F)cc1 |
| InChI | InChI=1S/C13H20FN5/c1-4-19(3)13(16)18-12(15)17-9(2)10-5-7-11(14)8-6-10/h5-9H,4H2,1-3H3,(H4,15,16,17,18) |
| InChIKey | JUPJEYPLFNVROD-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 80.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.34 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|