About bis(4-fluorophenyl)methyl N'-ethylcarbamimidothioate
bis(4-fluorophenyl)methyl N'-ethylcarbamimidothioate (PubChem CID 8774927) has the molecular formula C16H16F2N2S
and a molecular weight of 306.38 g/mol. Its IUPAC name is bis(4-fluorophenyl)methyl N'-ethylcarbamimidothioate.
Molecular Properties
| Compound Name | bis(4-fluorophenyl)methyl N'-ethylcarbamimidothioate |
| PubChem CID | 8774927 |
| Molecular Formula | C16H16F2N2S |
| Molecular Weight | 306.38 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | bis(4-fluorophenyl)methyl N'-ethylcarbamimidothioate |
| SMILES | CC/N=C(\N)SC(c1ccc(F)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C16H16F2N2S/c1-2-20-16(19)21-15(11-3-7-13(17)8-4-11)12-5-9-14(18)10-6-12/h3-10,15H,2H2,1H3,(H2,19,20) |
| InChIKey | JGGGYJSNNZPWJG-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.38 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze bis(4-fluorophenyl)methyl N'-ethylcarbamimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(4-fluorophenyl)methyl N'-ethylcarbamimidothioate?
The IUPAC name of bis(4-fluorophenyl)methyl N'-ethylcarbamimidothioate (CID 8774927) is bis(4-fluorophenyl)methyl N'-ethylcarbamimidothioate.
What is the SMILES notation for bis(4-fluorophenyl)methyl N'-ethylcarbamimidothioate?
The canonical SMILES for bis(4-fluorophenyl)methyl N'-ethylcarbamimidothioate is CC/N=C(\N)SC(c1ccc(F)cc1)c1ccc(F)cc1.
What is the InChIKey of bis(4-fluorophenyl)methyl N'-ethylcarbamimidothioate?
The InChIKey is JGGGYJSNNZPWJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16F2N2S/c1-2-20-16(19)21-15(11-3-7-13(17)8-4-11)12-5-9-14(18)10-6-12/h3-10,15H,2H2,1H3,(H2,19,20).
What are the key properties of bis(4-fluorophenyl)methyl N'-ethylcarbamimidothioate?
bis(4-fluorophenyl)methyl N'-ethylcarbamimidothioate has a molecular weight of 306.38 g/mol, XLogP of 4.12, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis(4-fluorophenyl)methyl N'-ethylcarbamimidothioate is sourced from PubChem (CID 8774927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).