C17H15F2NO3S — CID 7752640
(2-amino-2-oxoethyl) 2-[bis(4-fluorophenyl)methylsulfanyl]acetate (PubChem CID 7752640) has the molecular formula C17H15F2NO3S and a molecular weight of 351.37 g/mol. Its IUPAC name is (2-amino-2-oxoethyl) 2-[bis(4-fluorophenyl)methylsulfanyl]acetate.
| Compound Name | (2-amino-2-oxoethyl) 2-[bis(4-fluorophenyl)methylsulfanyl]acetate |
|---|---|
| PubChem CID | 7752640 |
| Molecular Formula | C17H15F2NO3S |
| Molecular Weight | 351.37 g/mol |
| Exact Mass | 351.07 |
| IUPAC Name | (2-amino-2-oxoethyl) 2-[bis(4-fluorophenyl)methylsulfanyl]acetate |
| SMILES | NC(=O)COC(=O)CSC(c1ccc(F)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H15F2NO3S/c18-13-5-1-11(2-6-13)17(12-3-7-14(19)8-4-12)24-10-16(22)23-9-15(20)21/h1-8,17H,9-10H2,(H2,20,21) |
| InChIKey | PCJFZRHYRRYZCK-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.37 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |