C14H20FNO2S — CID 55014940
ethyl 2-[2-amino-1-(4-fluorophenyl)butyl]sulfanylacetate (PubChem CID 55014940) has the molecular formula C14H20FNO2S and a molecular weight of 285.38 g/mol. Its IUPAC name is ethyl 2-[2-amino-1-(4-fluorophenyl)butyl]sulfanylacetate.
| Compound Name | ethyl 2-[2-amino-1-(4-fluorophenyl)butyl]sulfanylacetate |
|---|---|
| PubChem CID | 55014940 |
| Molecular Formula | C14H20FNO2S |
| Molecular Weight | 285.38 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | ethyl 2-[2-amino-1-(4-fluorophenyl)butyl]sulfanylacetate |
| SMILES | CCOC(=O)CSC(c1ccc(F)cc1)C(N)CC |
| InChI | InChI=1S/C14H20FNO2S/c1-3-12(16)14(19-9-13(17)18-4-2)10-5-7-11(15)8-6-10/h5-8,12,14H,3-4,9,16H2,1-2H3 |
| InChIKey | DHACDGDPPNYPGM-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.38 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |