C12H16FNO2S — CID 55014890
methyl 2-[2-amino-1-(4-fluorophenyl)propyl]sulfanylacetate (PubChem CID 55014890) has the molecular formula C12H16FNO2S and a molecular weight of 257.33 g/mol. Its IUPAC name is methyl 2-[2-amino-1-(4-fluorophenyl)propyl]sulfanylacetate.
| Compound Name | methyl 2-[2-amino-1-(4-fluorophenyl)propyl]sulfanylacetate |
|---|---|
| PubChem CID | 55014890 |
| Molecular Formula | C12H16FNO2S |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | methyl 2-[2-amino-1-(4-fluorophenyl)propyl]sulfanylacetate |
| SMILES | COC(=O)CSC(c1ccc(F)cc1)C(C)N |
| InChI | InChI=1S/C12H16FNO2S/c1-8(14)12(17-7-11(15)16-2)9-3-5-10(13)6-4-9/h3-6,8,12H,7,14H2,1-2H3 |
| InChIKey | MJVSLCCBXWSPQR-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |