C18H15F2NO2S — CID 7752634
[(1R)-1-cyanoethyl] 2-[bis(4-fluorophenyl)methylsulfanyl]acetate (PubChem CID 7752634) has the molecular formula C18H15F2NO2S and a molecular weight of 347.39 g/mol. Its IUPAC name is [(1R)-1-cyanoethyl] 2-[bis(4-fluorophenyl)methylsulfanyl]acetate.
| Compound Name | [(1R)-1-cyanoethyl] 2-[bis(4-fluorophenyl)methylsulfanyl]acetate |
|---|---|
| PubChem CID | 7752634 |
| Molecular Formula | C18H15F2NO2S |
| Molecular Weight | 347.39 g/mol |
| Exact Mass | 347.08 |
| IUPAC Name | [(1R)-1-cyanoethyl] 2-[bis(4-fluorophenyl)methylsulfanyl]acetate |
| SMILES | C[C@H](C#N)OC(=O)CSC(c1ccc(F)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H15F2NO2S/c1-12(10-21)23-17(22)11-24-18(13-2-6-15(19)7-3-13)14-4-8-16(20)9-5-14/h2-9,12,18H,11H2,1H3/t12-/m1/s1 |
| InChIKey | PGFHGOFLWCNUDR-GFCCVEGCSA-N |
| XLogP | 4.24 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.39 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |