propan-2-yl 2-(2-cyano-3-fluorophenyl)sulfanylacetate

C12H12FNO2S — CID 133353876

IUPACpropan-2-yl 2-(2-cyano-3-fluorophenyl)sulfanylacetate
SMILESCC(C)OC(=O)CSc1cccc(F)c1C#N
InChIInChI=1S/C12H12FNO2S/c1-8(2)16-12(15)7-17-11-5-3-4-10(13)9(11)6-14/h3-5,8H,7H2,1-2H3
InChIKeyVNVXICDSTZHPQQ-UHFFFAOYSA-N
MW253.30 g/mol
LogP2.74
Rot. Bonds4

About propan-2-yl 2-(2-cyano-3-fluorophenyl)sulfanylacetate

propan-2-yl 2-(2-cyano-3-fluorophenyl)sulfanylacetate (PubChem CID 133353876) has the molecular formula C12H12FNO2S and a molecular weight of 253.30 g/mol. Its IUPAC name is propan-2-yl 2-(2-cyano-3-fluorophenyl)sulfanylacetate.

Molecular Properties

Compound Namepropan-2-yl 2-(2-cyano-3-fluorophenyl)sulfanylacetate
PubChem CID133353876
Molecular FormulaC12H12FNO2S
Molecular Weight253.30 g/mol
Exact Mass253.06
IUPAC Namepropan-2-yl 2-(2-cyano-3-fluorophenyl)sulfanylacetate
SMILESCC(C)OC(=O)CSc1cccc(F)c1C#N
InChIInChI=1S/C12H12FNO2S/c1-8(2)16-12(15)7-17-11-5-3-4-10(13)9(11)6-14/h3-5,8H,7H2,1-2H3
InChIKeyVNVXICDSTZHPQQ-UHFFFAOYSA-N
XLogP2.74
TPSA50.09 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500253.30
LogP ≤ 52.74
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze propan-2-yl 2-(2-cyano-3-fluorophenyl)sulfanylacetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of propan-2-yl 2-(2-cyano-3-fluorophenyl)sulfanylacetate?
The IUPAC name of propan-2-yl 2-(2-cyano-3-fluorophenyl)sulfanylacetate (CID 133353876) is propan-2-yl 2-(2-cyano-3-fluorophenyl)sulfanylacetate.
What is the SMILES notation for propan-2-yl 2-(2-cyano-3-fluorophenyl)sulfanylacetate?
The canonical SMILES for propan-2-yl 2-(2-cyano-3-fluorophenyl)sulfanylacetate is CC(C)OC(=O)CSc1cccc(F)c1C#N.
What is the InChIKey of propan-2-yl 2-(2-cyano-3-fluorophenyl)sulfanylacetate?
The InChIKey is VNVXICDSTZHPQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12FNO2S/c1-8(2)16-12(15)7-17-11-5-3-4-10(13)9(11)6-14/h3-5,8H,7H2,1-2H3.
What are the key properties of propan-2-yl 2-(2-cyano-3-fluorophenyl)sulfanylacetate?
propan-2-yl 2-(2-cyano-3-fluorophenyl)sulfanylacetate has a molecular weight of 253.30 g/mol, XLogP of 2.74, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 2-(2-cyano-3-fluorophenyl)sulfanylacetate is sourced from PubChem (CID 133353876), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).