C18H14ClFN2O3S — CID 8977688
[(2S)-1-(3-chloro-4-cyanoanilino)-1-oxopropan-2-yl] 2-(2-fluorophenyl)sulfanylacetate (PubChem CID 8977688) has the molecular formula C18H14ClFN2O3S and a molecular weight of 392.84 g/mol. Its IUPAC name is [(2S)-1-(3-chloro-4-cyanoanilino)-1-oxopropan-2-yl] 2-(2-fluorophenyl)sulfanylacetate.
| Compound Name | [(2S)-1-(3-chloro-4-cyanoanilino)-1-oxopropan-2-yl] 2-(2-fluorophenyl)sulfanylacetate |
|---|---|
| PubChem CID | 8977688 |
| Molecular Formula | C18H14ClFN2O3S |
| Molecular Weight | 392.84 g/mol |
| Exact Mass | 392.04 |
| IUPAC Name | [(2S)-1-(3-chloro-4-cyanoanilino)-1-oxopropan-2-yl] 2-(2-fluorophenyl)sulfanylacetate |
| SMILES | C[C@H](OC(=O)CSc1ccccc1F)C(=O)Nc1ccc(C#N)c(Cl)c1 |
| InChI | InChI=1S/C18H14ClFN2O3S/c1-11(18(24)22-13-7-6-12(9-21)14(19)8-13)25-17(23)10-26-16-5-3-2-4-15(16)20/h2-8,11H,10H2,1H3,(H,22,24)/t11-/m0/s1 |
| InChIKey | SCSYKWOSEPDSJJ-NSHDSACASA-N |
| XLogP | 4.01 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.84 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |