C18H16ClN3O4S — CID 55425089
[1-(3-chloro-4-cyanoanilino)-1-oxopropan-2-yl] 3-(thiophene-3-carbonylamino)propanoate (PubChem CID 55425089) has the molecular formula C18H16ClN3O4S and a molecular weight of 405.86 g/mol. Its IUPAC name is [1-(3-chloro-4-cyanoanilino)-1-oxopropan-2-yl] 3-(thiophene-3-carbonylamino)propanoate.
| Compound Name | [1-(3-chloro-4-cyanoanilino)-1-oxopropan-2-yl] 3-(thiophene-3-carbonylamino)propanoate |
|---|---|
| PubChem CID | 55425089 |
| Molecular Formula | C18H16ClN3O4S |
| Molecular Weight | 405.86 g/mol |
| Exact Mass | 405.06 |
| IUPAC Name | [1-(3-chloro-4-cyanoanilino)-1-oxopropan-2-yl] 3-(thiophene-3-carbonylamino)propanoate |
| SMILES | CC(OC(=O)CCNC(=O)c1ccsc1)C(=O)Nc1ccc(C#N)c(Cl)c1 |
| InChI | InChI=1S/C18H16ClN3O4S/c1-11(17(24)22-14-3-2-12(9-20)15(19)8-14)26-16(23)4-6-21-18(25)13-5-7-27-10-13/h2-3,5,7-8,10-11H,4,6H2,1H3,(H,21,25)(H,22,24) |
| InChIKey | NLYNPHNDDXUYIW-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 108.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.86 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |