C18H19ClN4O5 — CID 8958353
[(2R)-1-(3-chloro-4-cyanoanilino)-1-oxopropan-2-yl] 4-(3-methyl-2,5-dioxoimidazolidin-1-yl)butanoate (PubChem CID 8958353) has the molecular formula C18H19ClN4O5 and a molecular weight of 406.83 g/mol. Its IUPAC name is [(2R)-1-(3-chloro-4-cyanoanilino)-1-oxopropan-2-yl] 4-(3-methyl-2,5-dioxoimidazolidin-1-yl)butanoate.
| Compound Name | [(2R)-1-(3-chloro-4-cyanoanilino)-1-oxopropan-2-yl] 4-(3-methyl-2,5-dioxoimidazolidin-1-yl)butanoate |
|---|---|
| PubChem CID | 8958353 |
| Molecular Formula | C18H19ClN4O5 |
| Molecular Weight | 406.83 g/mol |
| Exact Mass | 406.10 |
| IUPAC Name | [(2R)-1-(3-chloro-4-cyanoanilino)-1-oxopropan-2-yl] 4-(3-methyl-2,5-dioxoimidazolidin-1-yl)butanoate |
| SMILES | C[C@@H](OC(=O)CCCN1C(=O)CN(C)C1=O)C(=O)Nc1ccc(C#N)c(Cl)c1 |
| InChI | InChI=1S/C18H19ClN4O5/c1-11(17(26)21-13-6-5-12(9-20)14(19)8-13)28-16(25)4-3-7-23-15(24)10-22(2)18(23)27/h5-6,8,11H,3-4,7,10H2,1-2H3,(H,21,26)/t11-/m1/s1 |
| InChIKey | VXPDOHNBVNXXBD-LLVKDONJSA-N |
| XLogP | 1.76 |
| TPSA | 119.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.83 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|