C17H19F2N3O5 — CID 8958315
[(2R)-1-(3,4-difluoroanilino)-1-oxopropan-2-yl] 4-(3-methyl-2,5-dioxoimidazolidin-1-yl)butanoate (PubChem CID 8958315) has the molecular formula C17H19F2N3O5 and a molecular weight of 383.35 g/mol. Its IUPAC name is [(2R)-1-(3,4-difluoroanilino)-1-oxopropan-2-yl] 4-(3-methyl-2,5-dioxoimidazolidin-1-yl)butanoate.
| Compound Name | [(2R)-1-(3,4-difluoroanilino)-1-oxopropan-2-yl] 4-(3-methyl-2,5-dioxoimidazolidin-1-yl)butanoate |
|---|---|
| PubChem CID | 8958315 |
| Molecular Formula | C17H19F2N3O5 |
| Molecular Weight | 383.35 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | [(2R)-1-(3,4-difluoroanilino)-1-oxopropan-2-yl] 4-(3-methyl-2,5-dioxoimidazolidin-1-yl)butanoate |
| SMILES | C[C@@H](OC(=O)CCCN1C(=O)CN(C)C1=O)C(=O)Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C17H19F2N3O5/c1-10(16(25)20-11-5-6-12(18)13(19)8-11)27-15(24)4-3-7-22-14(23)9-21(2)17(22)26/h5-6,8,10H,3-4,7,9H2,1-2H3,(H,20,25)/t10-/m1/s1 |
| InChIKey | IDILZUYGHYGVED-SNVBAGLBSA-N |
| XLogP | 1.51 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.35 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|