C20H27N3O5 — CID 9061629
[2-[4-[(2R)-butan-2-yl]anilino]-2-oxoethyl] 4-(3-methyl-2,5-dioxoimidazolidin-1-yl)butanoate (PubChem CID 9061629) has the molecular formula C20H27N3O5 and a molecular weight of 389.45 g/mol. Its IUPAC name is [2-[4-[(2R)-butan-2-yl]anilino]-2-oxoethyl] 4-(3-methyl-2,5-dioxoimidazolidin-1-yl)butanoate.
| Compound Name | [2-[4-[(2R)-butan-2-yl]anilino]-2-oxoethyl] 4-(3-methyl-2,5-dioxoimidazolidin-1-yl)butanoate |
|---|---|
| PubChem CID | 9061629 |
| Molecular Formula | C20H27N3O5 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | [2-[4-[(2R)-butan-2-yl]anilino]-2-oxoethyl] 4-(3-methyl-2,5-dioxoimidazolidin-1-yl)butanoate |
| SMILES | CC[C@@H](C)c1ccc(NC(=O)COC(=O)CCCN2C(=O)CN(C)C2=O)cc1 |
| InChI | InChI=1S/C20H27N3O5/c1-4-14(2)15-7-9-16(10-8-15)21-17(24)13-28-19(26)6-5-11-23-18(25)12-22(3)20(23)27/h7-10,14H,4-6,11-13H2,1-3H3,(H,21,24)/t14-/m1/s1 |
| InChIKey | ORCLGHWUCNFRSP-CQSZACIVSA-N |
| XLogP | 2.36 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|