C22H25N3O5 — CID 8626531
[2-[[(1R)-1-naphthalen-1-ylethyl]amino]-2-oxoethyl] 4-(3-methyl-2,5-dioxoimidazolidin-1-yl)butanoate (PubChem CID 8626531) has the molecular formula C22H25N3O5 and a molecular weight of 411.46 g/mol. Its IUPAC name is [2-[[(1R)-1-naphthalen-1-ylethyl]amino]-2-oxoethyl] 4-(3-methyl-2,5-dioxoimidazolidin-1-yl)butanoate.
| Compound Name | [2-[[(1R)-1-naphthalen-1-ylethyl]amino]-2-oxoethyl] 4-(3-methyl-2,5-dioxoimidazolidin-1-yl)butanoate |
|---|---|
| PubChem CID | 8626531 |
| Molecular Formula | C22H25N3O5 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | [2-[[(1R)-1-naphthalen-1-ylethyl]amino]-2-oxoethyl] 4-(3-methyl-2,5-dioxoimidazolidin-1-yl)butanoate |
| SMILES | C[C@@H](NC(=O)COC(=O)CCCN1C(=O)CN(C)C1=O)c1cccc2ccccc12 |
| InChI | InChI=1S/C22H25N3O5/c1-15(17-10-5-8-16-7-3-4-9-18(16)17)23-19(26)14-30-21(28)11-6-12-25-20(27)13-24(2)22(25)29/h3-5,7-10,15H,6,11-14H2,1-2H3,(H,23,26)/t15-/m1/s1 |
| InChIKey | YOHJDJSXLPBDNF-OAHLLOKOSA-N |
| XLogP | 2.23 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|