C29H24N2O4 — CID 16587551
[2-(1-naphthalen-1-ylethylamino)-2-oxoethyl] 2-(9-oxoacridin-10-yl)acetate (PubChem CID 16587551) has the molecular formula C29H24N2O4 and a molecular weight of 464.52 g/mol. Its IUPAC name is [2-(1-naphthalen-1-ylethylamino)-2-oxoethyl] 2-(9-oxoacridin-10-yl)acetate.
| Compound Name | [2-(1-naphthalen-1-ylethylamino)-2-oxoethyl] 2-(9-oxoacridin-10-yl)acetate |
|---|---|
| PubChem CID | 16587551 |
| Molecular Formula | C29H24N2O4 |
| Molecular Weight | 464.52 g/mol |
| Exact Mass | 464.17 |
| IUPAC Name | [2-(1-naphthalen-1-ylethylamino)-2-oxoethyl] 2-(9-oxoacridin-10-yl)acetate |
| SMILES | CC(NC(=O)COC(=O)Cn1c2ccccc2c(=O)c2ccccc21)c1cccc2ccccc12 |
| InChI | InChI=1S/C29H24N2O4/c1-19(21-14-8-10-20-9-2-3-11-22(20)21)30-27(32)18-35-28(33)17-31-25-15-6-4-12-23(25)29(34)24-13-5-7-16-26(24)31/h2-16,19H,17-18H2,1H3,(H,30,32) |
| InChIKey | NMEQTFJVQYAZPK-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.52 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|