C30H24N2O4 — CID 16587232
[2-(benzhydrylamino)-2-oxoethyl] 2-(9-oxoacridin-10-yl)acetate (PubChem CID 16587232) has the molecular formula C30H24N2O4 and a molecular weight of 476.53 g/mol. Its IUPAC name is [2-(benzhydrylamino)-2-oxoethyl] 2-(9-oxoacridin-10-yl)acetate.
| Compound Name | [2-(benzhydrylamino)-2-oxoethyl] 2-(9-oxoacridin-10-yl)acetate |
|---|---|
| PubChem CID | 16587232 |
| Molecular Formula | C30H24N2O4 |
| Molecular Weight | 476.53 g/mol |
| Exact Mass | 476.17 |
| IUPAC Name | [2-(benzhydrylamino)-2-oxoethyl] 2-(9-oxoacridin-10-yl)acetate |
| SMILES | O=C(COC(=O)Cn1c2ccccc2c(=O)c2ccccc21)NC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H24N2O4/c33-27(31-29(21-11-3-1-4-12-21)22-13-5-2-6-14-22)20-36-28(34)19-32-25-17-9-7-15-23(25)30(35)24-16-8-10-18-26(24)32/h1-18,29H,19-20H2,(H,31,33) |
| InChIKey | WGNYFVUNCAPZNW-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.53 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|