C26H25N3O4 — CID 16612576
[2-[[4-(dimethylamino)phenyl]methylamino]-2-oxoethyl] 2-(9-oxoacridin-10-yl)acetate (PubChem CID 16612576) has the molecular formula C26H25N3O4 and a molecular weight of 443.50 g/mol. Its IUPAC name is [2-[[4-(dimethylamino)phenyl]methylamino]-2-oxoethyl] 2-(9-oxoacridin-10-yl)acetate.
| Compound Name | [2-[[4-(dimethylamino)phenyl]methylamino]-2-oxoethyl] 2-(9-oxoacridin-10-yl)acetate |
|---|---|
| PubChem CID | 16612576 |
| Molecular Formula | C26H25N3O4 |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.18 |
| IUPAC Name | [2-[[4-(dimethylamino)phenyl]methylamino]-2-oxoethyl] 2-(9-oxoacridin-10-yl)acetate |
| SMILES | CN(C)c1ccc(CNC(=O)COC(=O)Cn2c3ccccc3c(=O)c3ccccc32)cc1 |
| InChI | InChI=1S/C26H25N3O4/c1-28(2)19-13-11-18(12-14-19)15-27-24(30)17-33-25(31)16-29-22-9-5-3-7-20(22)26(32)21-8-4-6-10-23(21)29/h3-14H,15-17H2,1-2H3,(H,27,30) |
| InChIKey | NTRAGFJVWIFBHK-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|