C17H26N2O3 — CID 9200040
[2-[[4-(dimethylamino)phenyl]methylamino]-2-oxoethyl] 3,3-dimethylbutanoate (PubChem CID 9200040) has the molecular formula C17H26N2O3 and a molecular weight of 306.41 g/mol. Its IUPAC name is [2-[[4-(dimethylamino)phenyl]methylamino]-2-oxoethyl] 3,3-dimethylbutanoate.
| Compound Name | [2-[[4-(dimethylamino)phenyl]methylamino]-2-oxoethyl] 3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 9200040 |
| Molecular Formula | C17H26N2O3 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | [2-[[4-(dimethylamino)phenyl]methylamino]-2-oxoethyl] 3,3-dimethylbutanoate |
| SMILES | CN(C)c1ccc(CNC(=O)COC(=O)CC(C)(C)C)cc1 |
| InChI | InChI=1S/C17H26N2O3/c1-17(2,3)10-16(21)22-12-15(20)18-11-13-6-8-14(9-7-13)19(4)5/h6-9H,10-12H2,1-5H3,(H,18,20) |
| InChIKey | DGUUBEUFQAMITE-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|