C18H26N2O3 — CID 9202943
[2-[[4-(dimethylamino)phenyl]methylamino]-2-oxoethyl] 2-cyclopentylacetate (PubChem CID 9202943) has the molecular formula C18H26N2O3 and a molecular weight of 318.42 g/mol. Its IUPAC name is [2-[[4-(dimethylamino)phenyl]methylamino]-2-oxoethyl] 2-cyclopentylacetate.
| Compound Name | [2-[[4-(dimethylamino)phenyl]methylamino]-2-oxoethyl] 2-cyclopentylacetate |
|---|---|
| PubChem CID | 9202943 |
| Molecular Formula | C18H26N2O3 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | [2-[[4-(dimethylamino)phenyl]methylamino]-2-oxoethyl] 2-cyclopentylacetate |
| SMILES | CN(C)c1ccc(CNC(=O)COC(=O)CC2CCCC2)cc1 |
| InChI | InChI=1S/C18H26N2O3/c1-20(2)16-9-7-15(8-10-16)12-19-17(21)13-23-18(22)11-14-5-3-4-6-14/h7-10,14H,3-6,11-13H2,1-2H3,(H,19,21) |
| InChIKey | TXDJUOZIIWTAMH-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|