C15H24N2O3 — CID 75444272
N-[[4-(dimethylamino)phenyl]methyl]-2-(3-methoxypropoxy)acetamide (PubChem CID 75444272) has the molecular formula C15H24N2O3 and a molecular weight of 280.37 g/mol. Its IUPAC name is N-[[4-(dimethylamino)phenyl]methyl]-2-(3-methoxypropoxy)acetamide.
| Compound Name | N-[[4-(dimethylamino)phenyl]methyl]-2-(3-methoxypropoxy)acetamide |
|---|---|
| PubChem CID | 75444272 |
| Molecular Formula | C15H24N2O3 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | N-[[4-(dimethylamino)phenyl]methyl]-2-(3-methoxypropoxy)acetamide |
| SMILES | COCCCOCC(=O)NCc1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C15H24N2O3/c1-17(2)14-7-5-13(6-8-14)11-16-15(18)12-20-10-4-9-19-3/h5-8H,4,9-12H2,1-3H3,(H,16,18) |
| InChIKey | QWCOOSOAYKDEMZ-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|