C23H15F3N2O4 — CID 16612358
[2-oxo-2-(2,3,4-trifluoroanilino)ethyl] 2-(9-oxoacridin-10-yl)acetate (PubChem CID 16612358) has the molecular formula C23H15F3N2O4 and a molecular weight of 440.38 g/mol. Its IUPAC name is [2-oxo-2-(2,3,4-trifluoroanilino)ethyl] 2-(9-oxoacridin-10-yl)acetate.
| Compound Name | [2-oxo-2-(2,3,4-trifluoroanilino)ethyl] 2-(9-oxoacridin-10-yl)acetate |
|---|---|
| PubChem CID | 16612358 |
| Molecular Formula | C23H15F3N2O4 |
| Molecular Weight | 440.38 g/mol |
| Exact Mass | 440.10 |
| IUPAC Name | [2-oxo-2-(2,3,4-trifluoroanilino)ethyl] 2-(9-oxoacridin-10-yl)acetate |
| SMILES | O=C(COC(=O)Cn1c2ccccc2c(=O)c2ccccc21)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C23H15F3N2O4/c24-15-9-10-16(22(26)21(15)25)27-19(29)12-32-20(30)11-28-17-7-3-1-5-13(17)23(31)14-6-2-4-8-18(14)28/h1-10H,11-12H2,(H,27,29) |
| InChIKey | XCXNVQVZWGVOAD-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.38 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|