C26H22N2O6 — CID 16587255
ethyl 2-[[2-[2-(9-oxoacridin-10-yl)acetyl]oxyacetyl]amino]benzoate (PubChem CID 16587255) has the molecular formula C26H22N2O6 and a molecular weight of 458.47 g/mol. Its IUPAC name is ethyl 2-[[2-[2-(9-oxoacridin-10-yl)acetyl]oxyacetyl]amino]benzoate.
| Compound Name | ethyl 2-[[2-[2-(9-oxoacridin-10-yl)acetyl]oxyacetyl]amino]benzoate |
|---|---|
| PubChem CID | 16587255 |
| Molecular Formula | C26H22N2O6 |
| Molecular Weight | 458.47 g/mol |
| Exact Mass | 458.15 |
| IUPAC Name | ethyl 2-[[2-[2-(9-oxoacridin-10-yl)acetyl]oxyacetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccccc1NC(=O)COC(=O)Cn1c2ccccc2c(=O)c2ccccc21 |
| InChI | InChI=1S/C26H22N2O6/c1-2-33-26(32)17-9-3-6-12-20(17)27-23(29)16-34-24(30)15-28-21-13-7-4-10-18(21)25(31)19-11-5-8-14-22(19)28/h3-14H,2,15-16H2,1H3,(H,27,29) |
| InChIKey | HEQQJZOACUNMKM-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.47 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|