C18H16N2O5 — CID 4055331
ethyl 2-[[2-(2-oxo-1,3-benzoxazol-3-yl)acetyl]amino]benzoate (PubChem CID 4055331) has the molecular formula C18H16N2O5 and a molecular weight of 340.34 g/mol. Its IUPAC name is ethyl 2-[[2-(2-oxo-1,3-benzoxazol-3-yl)acetyl]amino]benzoate.
| Compound Name | ethyl 2-[[2-(2-oxo-1,3-benzoxazol-3-yl)acetyl]amino]benzoate |
|---|---|
| PubChem CID | 4055331 |
| Molecular Formula | C18H16N2O5 |
| Molecular Weight | 340.34 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | ethyl 2-[[2-(2-oxo-1,3-benzoxazol-3-yl)acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccccc1NC(=O)Cn1c(=O)oc2ccccc21 |
| InChI | InChI=1S/C18H16N2O5/c1-2-24-17(22)12-7-3-4-8-13(12)19-16(21)11-20-14-9-5-6-10-15(14)25-18(20)23/h3-10H,2,11H2,1H3,(H,19,21) |
| InChIKey | PALOKBCZQOSNJL-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.34 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |