C22H18N2O5S — CID 1259842
ethyl 2-[[2-(2-oxo-1,3-benzoxazol-3-yl)acetyl]amino]-4-phenylthiophene-3-carboxylate (PubChem CID 1259842) has the molecular formula C22H18N2O5S and a molecular weight of 422.46 g/mol. Its IUPAC name is ethyl 2-[[2-(2-oxo-1,3-benzoxazol-3-yl)acetyl]amino]-4-phenylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-(2-oxo-1,3-benzoxazol-3-yl)acetyl]amino]-4-phenylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 1259842 |
| Molecular Formula | C22H18N2O5S |
| Molecular Weight | 422.46 g/mol |
| Exact Mass | 422.09 |
| IUPAC Name | ethyl 2-[[2-(2-oxo-1,3-benzoxazol-3-yl)acetyl]amino]-4-phenylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccccc2)csc1NC(=O)Cn1c(=O)oc2ccccc21 |
| InChI | InChI=1S/C22H18N2O5S/c1-2-28-21(26)19-15(14-8-4-3-5-9-14)13-30-20(19)23-18(25)12-24-16-10-6-7-11-17(16)29-22(24)27/h3-11,13H,2,12H2,1H3,(H,23,25) |
| InChIKey | GXWRRXBUHMXCBN-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.46 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|