C17H13ClN2O5 — CID 38238411
methyl 2-chloro-5-[[2-(2-oxo-1,3-benzoxazol-3-yl)acetyl]amino]benzoate (PubChem CID 38238411) has the molecular formula C17H13ClN2O5 and a molecular weight of 360.75 g/mol. Its IUPAC name is methyl 2-chloro-5-[[2-(2-oxo-1,3-benzoxazol-3-yl)acetyl]amino]benzoate.
| Compound Name | methyl 2-chloro-5-[[2-(2-oxo-1,3-benzoxazol-3-yl)acetyl]amino]benzoate |
|---|---|
| PubChem CID | 38238411 |
| Molecular Formula | C17H13ClN2O5 |
| Molecular Weight | 360.75 g/mol |
| Exact Mass | 360.05 |
| IUPAC Name | methyl 2-chloro-5-[[2-(2-oxo-1,3-benzoxazol-3-yl)acetyl]amino]benzoate |
| SMILES | COC(=O)c1cc(NC(=O)Cn2c(=O)oc3ccccc32)ccc1Cl |
| InChI | InChI=1S/C17H13ClN2O5/c1-24-16(22)11-8-10(6-7-12(11)18)19-15(21)9-20-13-4-2-3-5-14(13)25-17(20)23/h2-8H,9H2,1H3,(H,19,21) |
| InChIKey | ORRYPIWFLMAFII-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.75 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |