C21H14N2O4 — CID 2961461
N-dibenzofuran-3-yl-2-(2-oxo-1,3-benzoxazol-3-yl)acetamide (PubChem CID 2961461) has the molecular formula C21H14N2O4 and a molecular weight of 358.35 g/mol. Its IUPAC name is N-dibenzofuran-3-yl-2-(2-oxo-1,3-benzoxazol-3-yl)acetamide.
| Compound Name | N-dibenzofuran-3-yl-2-(2-oxo-1,3-benzoxazol-3-yl)acetamide |
|---|---|
| PubChem CID | 2961461 |
| Molecular Formula | C21H14N2O4 |
| Molecular Weight | 358.35 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | N-dibenzofuran-3-yl-2-(2-oxo-1,3-benzoxazol-3-yl)acetamide |
| SMILES | O=C(Cn1c(=O)oc2ccccc21)Nc1ccc2c(c1)oc1ccccc12 |
| InChI | InChI=1S/C21H14N2O4/c24-20(12-23-16-6-2-4-8-18(16)27-21(23)25)22-13-9-10-15-14-5-1-3-7-17(14)26-19(15)11-13/h1-11H,12H2,(H,22,24) |
| InChIKey | SLBCHSZJPDDEEA-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.35 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |