C18H13N3O5 — CID 1293188
N-(2-methyl-1,3-dioxoisoindol-5-yl)-2-(2-oxo-1,3-benzoxazol-3-yl)acetamide (PubChem CID 1293188) has the molecular formula C18H13N3O5 and a molecular weight of 351.32 g/mol. Its IUPAC name is N-(2-methyl-1,3-dioxoisoindol-5-yl)-2-(2-oxo-1,3-benzoxazol-3-yl)acetamide.
| Compound Name | N-(2-methyl-1,3-dioxoisoindol-5-yl)-2-(2-oxo-1,3-benzoxazol-3-yl)acetamide |
|---|---|
| PubChem CID | 1293188 |
| Molecular Formula | C18H13N3O5 |
| Molecular Weight | 351.32 g/mol |
| Exact Mass | 351.09 |
| IUPAC Name | N-(2-methyl-1,3-dioxoisoindol-5-yl)-2-(2-oxo-1,3-benzoxazol-3-yl)acetamide |
| SMILES | CN1C(=O)c2ccc(NC(=O)Cn3c(=O)oc4ccccc43)cc2C1=O |
| InChI | InChI=1S/C18H13N3O5/c1-20-16(23)11-7-6-10(8-12(11)17(20)24)19-15(22)9-21-13-4-2-3-5-14(13)26-18(21)25/h2-8H,9H2,1H3,(H,19,22) |
| InChIKey | HAWPOOIEDMCSDU-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 101.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.32 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|