C23H16Cl2N2O4 — CID 16587212
[2-(2,5-dichloroanilino)-2-oxoethyl] 2-(9-oxoacridin-10-yl)acetate (PubChem CID 16587212) has the molecular formula C23H16Cl2N2O4 and a molecular weight of 455.30 g/mol. Its IUPAC name is [2-(2,5-dichloroanilino)-2-oxoethyl] 2-(9-oxoacridin-10-yl)acetate.
| Compound Name | [2-(2,5-dichloroanilino)-2-oxoethyl] 2-(9-oxoacridin-10-yl)acetate |
|---|---|
| PubChem CID | 16587212 |
| Molecular Formula | C23H16Cl2N2O4 |
| Molecular Weight | 455.30 g/mol |
| Exact Mass | 454.05 |
| IUPAC Name | [2-(2,5-dichloroanilino)-2-oxoethyl] 2-(9-oxoacridin-10-yl)acetate |
| SMILES | O=C(COC(=O)Cn1c2ccccc2c(=O)c2ccccc21)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C23H16Cl2N2O4/c24-14-9-10-17(25)18(11-14)26-21(28)13-31-22(29)12-27-19-7-3-1-5-15(19)23(30)16-6-2-4-8-20(16)27/h1-11H,12-13H2,(H,26,28) |
| InChIKey | YDWFYRPIGDBDQB-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.30 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|