C24H16ClF3N2O4 — CID 16587225
[2-[4-chloro-3-(trifluoromethyl)anilino]-2-oxoethyl] 2-(9-oxoacridin-10-yl)acetate (PubChem CID 16587225) has the molecular formula C24H16ClF3N2O4 and a molecular weight of 488.85 g/mol. Its IUPAC name is [2-[4-chloro-3-(trifluoromethyl)anilino]-2-oxoethyl] 2-(9-oxoacridin-10-yl)acetate.
| Compound Name | [2-[4-chloro-3-(trifluoromethyl)anilino]-2-oxoethyl] 2-(9-oxoacridin-10-yl)acetate |
|---|---|
| PubChem CID | 16587225 |
| Molecular Formula | C24H16ClF3N2O4 |
| Molecular Weight | 488.85 g/mol |
| Exact Mass | 488.08 |
| IUPAC Name | [2-[4-chloro-3-(trifluoromethyl)anilino]-2-oxoethyl] 2-(9-oxoacridin-10-yl)acetate |
| SMILES | O=C(COC(=O)Cn1c2ccccc2c(=O)c2ccccc21)Nc1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C24H16ClF3N2O4/c25-18-10-9-14(11-17(18)24(26,27)28)29-21(31)13-34-22(32)12-30-19-7-3-1-5-15(19)23(33)16-6-2-4-8-20(16)30/h1-11H,12-13H2,(H,29,31) |
| InChIKey | XYTZWIHLNWIIKN-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.85 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|