C20H14F3NO3 — CID 2089456
[2-oxo-2-(2,3,4-trifluoroanilino)ethyl] 2-naphthalen-1-ylacetate (PubChem CID 2089456) has the molecular formula C20H14F3NO3 and a molecular weight of 373.33 g/mol. Its IUPAC name is [2-oxo-2-(2,3,4-trifluoroanilino)ethyl] 2-naphthalen-1-ylacetate.
| Compound Name | [2-oxo-2-(2,3,4-trifluoroanilino)ethyl] 2-naphthalen-1-ylacetate |
|---|---|
| PubChem CID | 2089456 |
| Molecular Formula | C20H14F3NO3 |
| Molecular Weight | 373.33 g/mol |
| Exact Mass | 373.09 |
| IUPAC Name | [2-oxo-2-(2,3,4-trifluoroanilino)ethyl] 2-naphthalen-1-ylacetate |
| SMILES | O=C(COC(=O)Cc1cccc2ccccc12)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C20H14F3NO3/c21-15-8-9-16(20(23)19(15)22)24-17(25)11-27-18(26)10-13-6-3-5-12-4-1-2-7-14(12)13/h1-9H,10-11H2,(H,24,25) |
| InChIKey | WFKRNMZWKDANPG-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.33 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|