C22H20N2O4 — CID 2625330
[2-(4-acetamidoanilino)-2-oxoethyl] 2-naphthalen-1-ylacetate (PubChem CID 2625330) has the molecular formula C22H20N2O4 and a molecular weight of 376.41 g/mol. Its IUPAC name is [2-(4-acetamidoanilino)-2-oxoethyl] 2-naphthalen-1-ylacetate.
| Compound Name | [2-(4-acetamidoanilino)-2-oxoethyl] 2-naphthalen-1-ylacetate |
|---|---|
| PubChem CID | 2625330 |
| Molecular Formula | C22H20N2O4 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | [2-(4-acetamidoanilino)-2-oxoethyl] 2-naphthalen-1-ylacetate |
| SMILES | CC(=O)Nc1ccc(NC(=O)COC(=O)Cc2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C22H20N2O4/c1-15(25)23-18-9-11-19(12-10-18)24-21(26)14-28-22(27)13-17-7-4-6-16-5-2-3-8-20(16)17/h2-12H,13-14H2,1H3,(H,23,25)(H,24,26) |
| InChIKey | AEFQBMYRWXWTGX-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |