C21H18N2O4 — CID 2353518
[2-(4-carbamoylanilino)-2-oxoethyl] 2-naphthalen-1-ylacetate (PubChem CID 2353518) has the molecular formula C21H18N2O4 and a molecular weight of 362.39 g/mol. Its IUPAC name is [2-(4-carbamoylanilino)-2-oxoethyl] 2-naphthalen-1-ylacetate.
| Compound Name | [2-(4-carbamoylanilino)-2-oxoethyl] 2-naphthalen-1-ylacetate |
|---|---|
| PubChem CID | 2353518 |
| Molecular Formula | C21H18N2O4 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | [2-(4-carbamoylanilino)-2-oxoethyl] 2-naphthalen-1-ylacetate |
| SMILES | NC(=O)c1ccc(NC(=O)COC(=O)Cc2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C21H18N2O4/c22-21(26)15-8-10-17(11-9-15)23-19(24)13-27-20(25)12-16-6-3-5-14-4-1-2-7-18(14)16/h1-11H,12-13H2,(H2,22,26)(H,23,24) |
| InChIKey | MIGAPJXKEUHRRV-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |