C18H13F2N3O5 — CID 16580484
[2-(2,4-difluoroanilino)-2-oxoethyl] 2-(2,4-dioxoquinazolin-1-yl)acetate (PubChem CID 16580484) has the molecular formula C18H13F2N3O5 and a molecular weight of 389.31 g/mol. Its IUPAC name is [2-(2,4-difluoroanilino)-2-oxoethyl] 2-(2,4-dioxoquinazolin-1-yl)acetate.
| Compound Name | [2-(2,4-difluoroanilino)-2-oxoethyl] 2-(2,4-dioxoquinazolin-1-yl)acetate |
|---|---|
| PubChem CID | 16580484 |
| Molecular Formula | C18H13F2N3O5 |
| Molecular Weight | 389.31 g/mol |
| Exact Mass | 389.08 |
| IUPAC Name | [2-(2,4-difluoroanilino)-2-oxoethyl] 2-(2,4-dioxoquinazolin-1-yl)acetate |
| SMILES | O=C(COC(=O)Cn1c(=O)[nH]c(=O)c2ccccc21)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C18H13F2N3O5/c19-10-5-6-13(12(20)7-10)21-15(24)9-28-16(25)8-23-14-4-2-1-3-11(14)17(26)22-18(23)27/h1-7H,8-9H2,(H,21,24)(H,22,26,27) |
| InChIKey | OTLLGLHRQCUTIK-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 110.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.31 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |