C27H21N3O2 — CID 42933992
2-(9-oxoacridin-10-yl)-N-[phenyl(pyridin-2-yl)methyl]acetamide (PubChem CID 42933992) has the molecular formula C27H21N3O2 and a molecular weight of 419.48 g/mol. Its IUPAC name is 2-(9-oxoacridin-10-yl)-N-[phenyl(pyridin-2-yl)methyl]acetamide.
| Compound Name | 2-(9-oxoacridin-10-yl)-N-[phenyl(pyridin-2-yl)methyl]acetamide |
|---|---|
| PubChem CID | 42933992 |
| Molecular Formula | C27H21N3O2 |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.16 |
| IUPAC Name | 2-(9-oxoacridin-10-yl)-N-[phenyl(pyridin-2-yl)methyl]acetamide |
| SMILES | O=C(Cn1c2ccccc2c(=O)c2ccccc21)NC(c1ccccc1)c1ccccn1 |
| InChI | InChI=1S/C27H21N3O2/c31-25(29-26(19-10-2-1-3-11-19)22-14-8-9-17-28-22)18-30-23-15-6-4-12-20(23)27(32)21-13-5-7-16-24(21)30/h1-17,26H,18H2,(H,29,31) |
| InChIKey | ZWHHVXWJOZSBIG-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|