C21H16N4O5 — CID 55368097
2-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)-N-[phenyl(pyridin-2-yl)methyl]acetamide (PubChem CID 55368097) has the molecular formula C21H16N4O5 and a molecular weight of 404.38 g/mol. Its IUPAC name is 2-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)-N-[phenyl(pyridin-2-yl)methyl]acetamide.
| Compound Name | 2-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)-N-[phenyl(pyridin-2-yl)methyl]acetamide |
|---|---|
| PubChem CID | 55368097 |
| Molecular Formula | C21H16N4O5 |
| Molecular Weight | 404.38 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | 2-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)-N-[phenyl(pyridin-2-yl)methyl]acetamide |
| SMILES | O=C(Cn1c(=O)oc2cc([N+](=O)[O-])ccc21)NC(c1ccccc1)c1ccccn1 |
| InChI | InChI=1S/C21H16N4O5/c26-19(13-24-17-10-9-15(25(28)29)12-18(17)30-21(24)27)23-20(14-6-2-1-3-7-14)16-8-4-5-11-22-16/h1-12,20H,13H2,(H,23,26) |
| InChIKey | QKGRISZBVBFZOW-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 120.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.38 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|