C12H15FN2O2S — CID 47030874
2-[2-[1-(4-fluorophenyl)ethylamino]-2-oxoethyl]sulfanylacetamide (PubChem CID 47030874) has the molecular formula C12H15FN2O2S and a molecular weight of 270.33 g/mol. Its IUPAC name is 2-[2-[1-(4-fluorophenyl)ethylamino]-2-oxoethyl]sulfanylacetamide.
| Compound Name | 2-[2-[1-(4-fluorophenyl)ethylamino]-2-oxoethyl]sulfanylacetamide |
|---|---|
| PubChem CID | 47030874 |
| Molecular Formula | C12H15FN2O2S |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | 2-[2-[1-(4-fluorophenyl)ethylamino]-2-oxoethyl]sulfanylacetamide |
| SMILES | CC(NC(=O)CSCC(N)=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C12H15FN2O2S/c1-8(9-2-4-10(13)5-3-9)15-12(17)7-18-6-11(14)16/h2-5,8H,6-7H2,1H3,(H2,14,16)(H,15,17) |
| InChIKey | HVHJQIJHEIVVGW-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |