C14H21FN2OS — CID 66229426
2-(2-aminobutylsulfanyl)-N-[1-(4-fluorophenyl)ethyl]acetamide (PubChem CID 66229426) has the molecular formula C14H21FN2OS and a molecular weight of 284.40 g/mol. Its IUPAC name is 2-(2-aminobutylsulfanyl)-N-[1-(4-fluorophenyl)ethyl]acetamide.
| Compound Name | 2-(2-aminobutylsulfanyl)-N-[1-(4-fluorophenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 66229426 |
| Molecular Formula | C14H21FN2OS |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | 2-(2-aminobutylsulfanyl)-N-[1-(4-fluorophenyl)ethyl]acetamide |
| SMILES | CCC(N)CSCC(=O)NC(C)c1ccc(F)cc1 |
| InChI | InChI=1S/C14H21FN2OS/c1-3-13(16)8-19-9-14(18)17-10(2)11-4-6-12(15)7-5-11/h4-7,10,13H,3,8-9,16H2,1-2H3,(H,17,18) |
| InChIKey | NQQFZFANWSYZEC-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |