C12H20N2OS2 — CID 66228221
2-(2-aminobutylsulfanyl)-N-(1-thiophen-2-ylethyl)acetamide (PubChem CID 66228221) has the molecular formula C12H20N2OS2 and a molecular weight of 272.44 g/mol. Its IUPAC name is 2-(2-aminobutylsulfanyl)-N-(1-thiophen-2-ylethyl)acetamide.
| Compound Name | 2-(2-aminobutylsulfanyl)-N-(1-thiophen-2-ylethyl)acetamide |
|---|---|
| PubChem CID | 66228221 |
| Molecular Formula | C12H20N2OS2 |
| Molecular Weight | 272.44 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | 2-(2-aminobutylsulfanyl)-N-(1-thiophen-2-ylethyl)acetamide |
| SMILES | CCC(N)CSCC(=O)NC(C)c1cccs1 |
| InChI | InChI=1S/C12H20N2OS2/c1-3-10(13)7-16-8-12(15)14-9(2)11-5-4-6-17-11/h4-6,9-10H,3,7-8,13H2,1-2H3,(H,14,15) |
| InChIKey | UXOHUWLZDUFUOL-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.44 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |